C22H34O — CID 10567298
(1S,2S,15S)-2-phenylbicyclo[13.1.0]hexadecan-2-ol (PubChem CID 10567298) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (1S,2S,15S)-2-phenylbicyclo[13.1.0]hexadecan-2-ol.
| Compound Name | (1S,2S,15S)-2-phenylbicyclo[13.1.0]hexadecan-2-ol |
|---|---|
| PubChem CID | 10567298 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (1S,2S,15S)-2-phenylbicyclo[13.1.0]hexadecan-2-ol |
| SMILES | O[C@@]1(c2ccccc2)CCCCCCCCCCCC[C@H]2C[C@@H]21 |
| InChI | InChI=1S/C22H34O/c23-22(20-15-11-9-12-16-20)17-13-8-6-4-2-1-3-5-7-10-14-19-18-21(19)22/h9,11-12,15-16,19,21,23H,1-8,10,13-14,17-18H2/t19-,21-,22+/m0/s1 |
| InChIKey | GUGZAESQWYJXCD-ILWGZMRPSA-N |
| XLogP | 6.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |