C20H31N — CID 130330510
N,N-diethyl-2-(1-phenylcycloheptyl)prop-2-en-1-amine (PubChem CID 130330510) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N,N-diethyl-2-(1-phenylcycloheptyl)prop-2-en-1-amine.
| Compound Name | N,N-diethyl-2-(1-phenylcycloheptyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 130330510 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N,N-diethyl-2-(1-phenylcycloheptyl)prop-2-en-1-amine |
| SMILES | C=C(CN(CC)CC)C1(c2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C20H31N/c1-4-21(5-2)17-18(3)20(15-11-6-7-12-16-20)19-13-9-8-10-14-19/h8-10,13-14H,3-7,11-12,15-17H2,1-2H3 |
| InChIKey | DRRKKIXIYBXNKW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|