C11H16O2 — CID 144936918
(3E,5E)-6-(cyclopropylmethoxy)hepta-1,3,5-trien-3-ol (PubChem CID 144936918) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3E,5E)-6-(cyclopropylmethoxy)hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-6-(cyclopropylmethoxy)hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 144936918 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3E,5E)-6-(cyclopropylmethoxy)hepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)OCC1CC1 |
| InChI | InChI=1S/C11H16O2/c1-3-11(12)7-4-9(2)13-8-10-5-6-10/h3-4,7,10,12H,1,5-6,8H2,2H3/b9-4+,11-7+ |
| InChIKey | LPPBZJOVMAHFJD-BFFNUNQPSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|