C15H23N3O — CID 138601250
[1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]cyclopropyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 138601250) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is [1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]cyclopropyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]cyclopropyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 138601250 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | [1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]cyclopropyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | C=N/C(=C\C=C/C)C1(C(=O)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C15H23N3O/c1-4-5-6-13(16-2)15(7-8-15)14(19)18-11-9-17(3)10-12-18/h4-6H,2,7-12H2,1,3H3/b5-4-,13-6- |
| InChIKey | MHDWRDGXXBZSHN-YIDBNINZSA-N |
| XLogP | 1.70 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|