C15H25N3O — CID 143501797
4-methyl-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,4-diazepane-1-carboxamide (PubChem CID 143501797) has the molecular formula C15H25N3O and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-methyl-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-methyl-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 143501797 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-methyl-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,4-diazepane-1-carboxamide |
| SMILES | C/C=C\C=C(/C=C\C)NC(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C15H25N3O/c1-4-6-9-14(8-5-2)16-15(19)18-11-7-10-17(3)12-13-18/h4-6,8-9H,7,10-13H2,1-3H3,(H,16,19)/b6-4-,8-5-,14-9+ |
| InChIKey | ZABQNACUMQNKFU-KICHBQDWSA-N |
| XLogP | 2.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|