C11H18N4O2 — CID 155020937
N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidine-1-carboxamide (PubChem CID 155020937) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 155020937 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]pyrrolidine-1-carboxamide |
| SMILES | C/C=C\C(=N/N(C)C=O)NC(=O)N1CCCC1 |
| InChI | InChI=1S/C11H18N4O2/c1-3-6-10(13-14(2)9-16)12-11(17)15-7-4-5-8-15/h3,6,9H,4-5,7-8H2,1-2H3,(H,12,13,17)/b6-3- |
| InChIKey | UCKWSCJRBWITHE-UTCJRWHESA-N |
| XLogP | 0.77 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|