C10H16N2O — CID 6140892
N-[(1Z,3E)-penta-1,3-dienyl]pyrrolidine-1-carboxamide (PubChem CID 6140892) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[(1Z,3E)-penta-1,3-dienyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(1Z,3E)-penta-1,3-dienyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 6140892 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[(1Z,3E)-penta-1,3-dienyl]pyrrolidine-1-carboxamide |
| SMILES | C/C=C/C=C\NC(=O)N1CCCC1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-4-7-11-10(13)12-8-5-6-9-12/h2-4,7H,5-6,8-9H2,1H3,(H,11,13)/b3-2+,7-4- |
| InChIKey | KKTZDQVPCVKRKV-SWBALALESA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|