C12H20N4O — CID 145130222
N-[(E)-3-[[(Z)-but-2-enylidene]amino]butan-2-ylideneamino]azetidine-1-carboxamide (PubChem CID 145130222) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is N-[(E)-3-[[(Z)-but-2-enylidene]amino]butan-2-ylideneamino]azetidine-1-carboxamide.
| Compound Name | N-[(E)-3-[[(Z)-but-2-enylidene]amino]butan-2-ylideneamino]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 145130222 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-[(E)-3-[[(Z)-but-2-enylidene]amino]butan-2-ylideneamino]azetidine-1-carboxamide |
| SMILES | C/C=C\C=N\C(C)/C(C)=N/NC(=O)N1CCC1 |
| InChI | InChI=1S/C12H20N4O/c1-4-5-7-13-10(2)11(3)14-15-12(17)16-8-6-9-16/h4-5,7,10H,6,8-9H2,1-3H3,(H,15,17)/b5-4-,13-7+,14-11+ |
| InChIKey | XHTKTYQBZAFLQW-CABUBAICSA-N |
| XLogP | 1.81 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|