C19H25FN4O2 — CID 155021016
4-[(3-fluorophenyl)methyl]-N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]piperidine-1-carboxamide (PubChem CID 155021016) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]piperidine-1-carboxamide.
| Compound Name | 4-[(3-fluorophenyl)methyl]-N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 155021016 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-N-[(E)-N-[formyl(methyl)amino]-C-[(Z)-prop-1-enyl]carbonimidoyl]piperidine-1-carboxamide |
| SMILES | C/C=C\C(=N/N(C)C=O)NC(=O)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H25FN4O2/c1-3-5-18(22-23(2)14-25)21-19(26)24-10-8-15(9-11-24)12-16-6-4-7-17(20)13-16/h3-7,13-15H,8-12H2,1-2H3,(H,21,22,26)/b5-3- |
| InChIKey | MURBUZULXLGBPW-HYXAFXHYSA-N |
| XLogP | 2.77 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|