C14H26N2 — CID 142829570
ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 142829570) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142829570 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C(/C=C\C=C/C)N1CCN(C)CC1.CC |
| InChI | InChI=1S/C12H20N2.C2H6/c1-4-5-6-7-12(2)14-10-8-13(3)9-11-14;1-2/h4-7H,2,8-11H2,1,3H3;1-2H3/b5-4-,7-6-; |
| InChIKey | SAMUKRDRDKHTNN-CYSANHHKSA-N |
| XLogP | 2.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|