About ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one
ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one (PubChem CID 142088727) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one.
Molecular Properties
| Compound Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one |
| PubChem CID | 142088727 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one |
| SMILES | C=C/C=C\C(=C)N1CCC(=O)CC1.CC |
| InChI | InChI=1S/C11H15NO.C2H6/c1-3-4-5-10(2)12-8-6-11(13)7-9-12;1-2/h3-5H,1-2,6-9H2;1-2H3/b5-4-; |
| InChIKey | FODOWVYBKYUNNN-MKWAYWHRSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one?
The IUPAC name of ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one (CID 142088727) is ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one.
What is the SMILES notation for ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one?
The canonical SMILES for ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one is C=C/C=C\C(=C)N1CCC(=O)CC1.CC.
What is the InChIKey of ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one?
The InChIKey is FODOWVYBKYUNNN-MKWAYWHRSA-N. The full InChI is InChI=1S/C11H15NO.C2H6/c1-3-4-5-10(2)12-8-6-11(13)7-9-12;1-2/h3-5H,1-2,6-9H2;1-2H3/b5-4-;.
What are the key properties of ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one?
ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one has a molecular weight of 207.32 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]piperidin-4-one is sourced from PubChem (CID 142088727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).