C14H24N2O — CID 142109087
1-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]piperidin-4-one;ethane (PubChem CID 142109087) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]piperidin-4-one;ethane.
| Compound Name | 1-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]piperidin-4-one;ethane |
|---|---|
| PubChem CID | 142109087 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]piperidin-4-one;ethane |
| SMILES | C=C/C(=C\C=C(/C)N)N1CCC(=O)CC1.CC |
| InChI | InChI=1S/C12H18N2O.C2H6/c1-3-11(5-4-10(2)13)14-8-6-12(15)7-9-14;1-2/h3-5H,1,6-9,13H2,2H3;1-2H3/b10-4+,11-5+; |
| InChIKey | UFPXIXSANIQHDC-DVHWKNMOSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|