C12H19NO2 — CID 143407668
1-[(Z)-4,4-dimethylpent-2-enoyl]piperidin-4-one (PubChem CID 143407668) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[(Z)-4,4-dimethylpent-2-enoyl]piperidin-4-one.
| Compound Name | 1-[(Z)-4,4-dimethylpent-2-enoyl]piperidin-4-one |
|---|---|
| PubChem CID | 143407668 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-[(Z)-4,4-dimethylpent-2-enoyl]piperidin-4-one |
| SMILES | CC(C)(C)/C=C\C(=O)N1CCC(=O)CC1 |
| InChI | InChI=1S/C12H19NO2/c1-12(2,3)7-4-11(15)13-8-5-10(14)6-9-13/h4,7H,5-6,8-9H2,1-3H3/b7-4- |
| InChIKey | DKORDAOPQYJEPG-DAXSKMNVSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|