C13H24N2 — CID 142322995
ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylazetidin-3-amine (PubChem CID 142322995) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylazetidin-3-amine.
| Compound Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylazetidin-3-amine |
|---|---|
| PubChem CID | 142322995 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylazetidin-3-amine |
| SMILES | C=C(/C=C\C=C/C)N1CC(C)(N)C1.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-4-5-6-7-10(2)13-8-11(3,12)9-13;1-2/h4-7H,2,8-9,12H2,1,3H3;1-2H3/b5-4-,7-6-; |
| InChIKey | ZWFJXQVVCQPRGQ-CYSANHHKSA-N |
| XLogP | 2.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|