C14H18F2N2 — CID 143883909
(4Z,6Z)-2-(4,4-difluoropiperidin-1-yl)-3-methylideneocta-4,6-dienenitrile (PubChem CID 143883909) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (4Z,6Z)-2-(4,4-difluoropiperidin-1-yl)-3-methylideneocta-4,6-dienenitrile.
| Compound Name | (4Z,6Z)-2-(4,4-difluoropiperidin-1-yl)-3-methylideneocta-4,6-dienenitrile |
|---|---|
| PubChem CID | 143883909 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (4Z,6Z)-2-(4,4-difluoropiperidin-1-yl)-3-methylideneocta-4,6-dienenitrile |
| SMILES | C=C(/C=C\C=C/C)C(C#N)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H18F2N2/c1-3-4-5-6-12(2)13(11-17)18-9-7-14(15,16)8-10-18/h3-6,13H,2,7-10H2,1H3/b4-3-,6-5- |
| InChIKey | MMWGUPDYEGZDJY-OUPQRBNQSA-N |
| XLogP | 3.30 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|