C16H23N — CID 143151394
1-[(3E,7Z,9Z)-4-methyl-6-methylideneundeca-1,3,7,9-tetraen-5-yl]azetidine (PubChem CID 143151394) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-[(3E,7Z,9Z)-4-methyl-6-methylideneundeca-1,3,7,9-tetraen-5-yl]azetidine.
| Compound Name | 1-[(3E,7Z,9Z)-4-methyl-6-methylideneundeca-1,3,7,9-tetraen-5-yl]azetidine |
|---|---|
| PubChem CID | 143151394 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-[(3E,7Z,9Z)-4-methyl-6-methylideneundeca-1,3,7,9-tetraen-5-yl]azetidine |
| SMILES | C=C/C=C(\C)C(C(=C)/C=C\C=C/C)N1CCC1 |
| InChI | InChI=1S/C16H23N/c1-5-7-8-11-15(4)16(14(3)10-6-2)17-12-9-13-17/h5-8,10-11,16H,2,4,9,12-13H2,1,3H3/b7-5-,11-8-,14-10+ |
| InChIKey | HWTCSTPQQXIXIZ-DLUHIXOSSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|