C10H18NP — CID 176995030
(3Z,5Z)-2-methylidene-N-(1-phosphanylethyl)hepta-3,5-dien-1-amine (PubChem CID 176995030) has the molecular formula C10H18NP and a molecular weight of 183.24 g/mol. Its IUPAC name is (3Z,5Z)-2-methylidene-N-(1-phosphanylethyl)hepta-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-2-methylidene-N-(1-phosphanylethyl)hepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 176995030 |
| Molecular Formula | C10H18NP |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | (3Z,5Z)-2-methylidene-N-(1-phosphanylethyl)hepta-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C=C/C)CNC(C)P |
| InChI | InChI=1S/C10H18NP/c1-4-5-6-7-9(2)8-11-10(3)12/h4-7,10-11H,2,8,12H2,1,3H3/b5-4-,7-6- |
| InChIKey | HSMHDJNISSPTLC-RZSVFLSASA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|