C8H13NO — CID 142817830
N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N-methylhydroxylamine (PubChem CID 142817830) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N-methylhydroxylamine.
| Compound Name | N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 142817830 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N-methylhydroxylamine |
| SMILES | C=C(/C=C\C=C/C)N(C)O |
| InChI | InChI=1S/C8H13NO/c1-4-5-6-7-8(2)9(3)10/h4-7,10H,2H2,1,3H3/b5-4-,7-6- |
| InChIKey | IHPKUCVCGTVNLZ-RZSVFLSASA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|