C13H16N4 — CID 167287464
3-methanimidoyl-N-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]pyrazin-2-amine (PubChem CID 167287464) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-methanimidoyl-N-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]pyrazin-2-amine.
| Compound Name | 3-methanimidoyl-N-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 167287464 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-methanimidoyl-N-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]pyrazin-2-amine |
| SMILES | [H]/N=C/c1nccnc1NCC(=C)/C=C\C=C/C |
| InChI | InChI=1S/C13H16N4/c1-3-4-5-6-11(2)10-17-13-12(9-14)15-7-8-16-13/h3-9,14H,2,10H2,1H3,(H,16,17)/b4-3-,6-5-,14-9+ |
| InChIKey | NMGWIAICXQUTAD-KXTJGOHOSA-N |
| XLogP | 2.57 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|