C14H19F3N4 — CID 107380965
N-[[5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]methyl]propan-1-amine (PubChem CID 107380965) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[[5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107380965 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[[5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CC=C(C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C14H19F3N4/c1-2-5-18-8-12-9-20-13(10-19-12)21-6-3-11(4-7-21)14(15,16)17/h3,9-10,18H,2,4-8H2,1H3 |
| InChIKey | JQAHBXAAZAPPLD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|