C14H17F3N4 — CID 114490536
N-[[6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-3-yl]methyl]cyclopropanamine (PubChem CID 114490536) has the molecular formula C14H17F3N4 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-[[6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114490536 |
| Molecular Formula | C14H17F3N4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[[6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-3-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)C1=CCN(c2ccc(CNC3CC3)nn2)CC1 |
| InChI | InChI=1S/C14H17F3N4/c15-14(16,17)10-5-7-21(8-6-10)13-4-3-12(19-20-13)9-18-11-1-2-11/h3-5,11,18H,1-2,6-9H2 |
| InChIKey | CZTXDZDEGOXSNJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|