About N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine
N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine (PubChem CID 94391222) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine |
| PubChem CID | 94391222 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine |
| SMILES | C[C@@H]1CN(c2ccc(CNC3CC3)nn2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H22N4O/c1-10-8-18(9-11(2)19-10)14-6-5-13(16-17-14)7-15-12-3-4-12/h5-6,10-12,15H,3-4,7-9H2,1-2H3/t10-,11+ |
| InChIKey | ZRLKMUPPIYDRBI-PHIMTYICSA-N |
| XLogP | 1.34 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine (CID 94391222) is N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine is C[C@@H]1CN(c2ccc(CNC3CC3)nn2)C[C@H](C)O1.
What is the InChIKey of N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine?
The InChIKey is ZRLKMUPPIYDRBI-PHIMTYICSA-N. The full InChI is InChI=1S/C14H22N4O/c1-10-8-18(9-11(2)19-10)14-6-5-13(16-17-14)7-15-12-3-4-12/h5-6,10-12,15H,3-4,7-9H2,1-2H3/t10-,11+.
What are the key properties of N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine?
N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine has a molecular weight of 262.36 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]methyl]cyclopropanamine is sourced from PubChem (CID 94391222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).