C18H27N3 — CID 114460779
N-[[4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]cyclopropanamine (PubChem CID 114460779) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[[4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114460779 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[[4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]cyclopropanamine |
| SMILES | CC(C)(C)C1=CCN(c2ccnc(CNC3CC3)c2)CC1 |
| InChI | InChI=1S/C18H27N3/c1-18(2,3)14-7-10-21(11-8-14)17-6-9-19-16(12-17)13-20-15-4-5-15/h6-7,9,12,15,20H,4-5,8,10-11,13H2,1-3H3 |
| InChIKey | JHASAZGMOBLMIG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|