C15H26N4S — CID 107459587
N-[[5-(7,7-dimethyl-1,4-thiazepan-4-yl)pyrazin-2-yl]methyl]propan-1-amine (PubChem CID 107459587) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is N-[[5-(7,7-dimethyl-1,4-thiazepan-4-yl)pyrazin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(7,7-dimethyl-1,4-thiazepan-4-yl)pyrazin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107459587 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[[5-(7,7-dimethyl-1,4-thiazepan-4-yl)pyrazin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CCSC(C)(C)CC2)cn1 |
| InChI | InChI=1S/C15H26N4S/c1-4-6-16-10-13-11-18-14(12-17-13)19-7-5-15(2,3)20-9-8-19/h11-12,16H,4-10H2,1-3H3 |
| InChIKey | NYCOCNIZZSHUHD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|