C14H25N3S2 — CID 107459872
N-[[2-(7,7-dimethyl-1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine (PubChem CID 107459872) has the molecular formula C14H25N3S2 and a molecular weight of 299.51 g/mol. Its IUPAC name is N-[[2-(7,7-dimethyl-1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(7,7-dimethyl-1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107459872 |
| Molecular Formula | C14H25N3S2 |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[[2-(7,7-dimethyl-1,4-thiazepan-4-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1csc(N2CCSC(C)(C)CC2)n1 |
| InChI | InChI=1S/C14H25N3S2/c1-4-6-15-10-12-11-18-13(16-12)17-7-5-14(2,3)19-9-8-17/h11,15H,4-10H2,1-3H3 |
| InChIKey | YAHGUPXDESUKON-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|