About (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide
(3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide (PubChem CID 145063877) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide.
Molecular Properties
| Compound Name | (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide |
| PubChem CID | 145063877 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide |
| SMILES | C=C(/C=C\C=C/C)/C(N)=N/C |
| InChI | InChI=1S/C9H14N2/c1-4-5-6-7-8(2)9(10)11-3/h4-7H,2H2,1,3H3,(H2,10,11)/b5-4-,7-6- |
| InChIKey | IMKGOGAHTNLSMX-RZSVFLSASA-N |
| XLogP | 1.66 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide?
The IUPAC name of (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide (CID 145063877) is (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide.
What is the SMILES notation for (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide?
The canonical SMILES for (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide is C=C(/C=C\C=C/C)/C(N)=N/C.
What is the InChIKey of (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide?
The InChIKey is IMKGOGAHTNLSMX-RZSVFLSASA-N. The full InChI is InChI=1S/C9H14N2/c1-4-5-6-7-8(2)9(10)11-3/h4-7H,2H2,1,3H3,(H2,10,11)/b5-4-,7-6-.
What are the key properties of (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide?
(3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide has a molecular weight of 150.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-N'-methyl-2-methylidenehepta-3,5-dienimidamide is sourced from PubChem (CID 145063877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).