C16H30N2 — CID 177053447
1-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-methylpiperazine;ethane (PubChem CID 177053447) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-methylpiperazine;ethane.
| Compound Name | 1-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-methylpiperazine;ethane |
|---|---|
| PubChem CID | 177053447 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-4-methylpiperazine;ethane |
| SMILES | C=C(C)/C(=C\C=C(C)C)N1CCN(C)CC1.CC |
| InChI | InChI=1S/C14H24N2.C2H6/c1-12(2)6-7-14(13(3)4)16-10-8-15(5)9-11-16;1-2/h6-7H,3,8-11H2,1-2,4-5H3;1-2H3/b14-7+; |
| InChIKey | WDGJBIWZPLOCLQ-FJUODKGNSA-N |
| XLogP | 3.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|