About formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone
formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 143691065) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone.
Molecular Properties
| Compound Name | formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone |
| PubChem CID | 143691065 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | C.C=O.CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C7H14N2O.CH2O.CH4/c1-7(10)9-5-3-8(2)4-6-9;1-2;/h3-6H2,1-2H3;1H2;1H4 |
| InChIKey | IVONPHBXBNGRLX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone?
The IUPAC name of formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone (CID 143691065) is formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone.
What is the SMILES notation for formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone?
The canonical SMILES for formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone is C.C=O.CC(=O)N1CCN(C)CC1.
What is the InChIKey of formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone?
The InChIKey is IVONPHBXBNGRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.CH2O.CH4/c1-7(10)9-5-3-8(2)4-6-9;1-2;/h3-6H2,1-2H3;1H2;1H4.
What are the key properties of formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone?
formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone has a molecular weight of 188.27 g/mol, XLogP of 0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methane;1-(4-methylpiperazin-1-yl)ethanone is sourced from PubChem (CID 143691065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).