C14H25N3 — CID 155721811
(3Z)-5-(4-methylpiperazin-1-yl)-3-propylhexa-1,3,5-trien-2-amine (PubChem CID 155721811) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (3Z)-5-(4-methylpiperazin-1-yl)-3-propylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-(4-methylpiperazin-1-yl)-3-propylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 155721811 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (3Z)-5-(4-methylpiperazin-1-yl)-3-propylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C(=C\C(=C)N1CCN(C)CC1)CCC |
| InChI | InChI=1S/C14H25N3/c1-5-6-14(13(3)15)11-12(2)17-9-7-16(4)8-10-17/h11H,2-3,5-10,15H2,1,4H3/b14-11- |
| InChIKey | WGJATFJUWKRGIN-KAMYIIQDSA-N |
| XLogP | 1.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|