C8H13NO2S — CID 142175169
(3E,5Z)-2-methylhepta-1,3,5-triene-3-sulfonamide (PubChem CID 142175169) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is (3E,5Z)-2-methylhepta-1,3,5-triene-3-sulfonamide.
| Compound Name | (3E,5Z)-2-methylhepta-1,3,5-triene-3-sulfonamide |
|---|---|
| PubChem CID | 142175169 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (3E,5Z)-2-methylhepta-1,3,5-triene-3-sulfonamide |
| SMILES | C=C(C)/C(=C\C=C/C)S(N)(=O)=O |
| InChI | InChI=1S/C8H13NO2S/c1-4-5-6-8(7(2)3)12(9,10)11/h4-6H,2H2,1,3H3,(H2,9,10,11)/b5-4-,8-6+ |
| InChIKey | PILWGKVWAFLUAY-GSGSLZOQSA-N |
| XLogP | 1.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|