C14H23N — CID 156752662
(3E,5Z)-2-methyl-N-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-1,3,5-trien-3-amine (PubChem CID 156752662) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3E,5Z)-2-methyl-N-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-2-methyl-N-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156752662 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3E,5Z)-2-methyl-N-propan-2-yl-N-[(Z)-prop-1-enyl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(=C\C=C/C)N(/C=C\C)C(C)C |
| InChI | InChI=1S/C14H23N/c1-7-9-10-14(12(3)4)15(11-8-2)13(5)6/h7-11,13H,3H2,1-2,4-6H3/b9-7-,11-8-,14-10+ |
| InChIKey | YBXFQSHHNWABRI-GUWVGYBZSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|