C9H12Cl2 — CID 23272827
(4Z,6Z)-4,7-dichloro-2-methylocta-2,4,6-triene (PubChem CID 23272827) has the molecular formula C9H12Cl2 and a molecular weight of 191.10 g/mol. Its IUPAC name is (4Z,6Z)-4,7-dichloro-2-methylocta-2,4,6-triene.
| Compound Name | (4Z,6Z)-4,7-dichloro-2-methylocta-2,4,6-triene |
|---|---|
| PubChem CID | 23272827 |
| Molecular Formula | C9H12Cl2 |
| Molecular Weight | 191.10 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | (4Z,6Z)-4,7-dichloro-2-methylocta-2,4,6-triene |
| SMILES | CC(C)=C/C(Cl)=C/C=C(/C)Cl |
| InChI | InChI=1S/C9H12Cl2/c1-7(2)6-9(11)5-4-8(3)10/h4-6H,1-3H3/b8-4-,9-5- |
| InChIKey | VGZWHZYOEFHZOD-XEQVNJCQSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|