(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid

C7H9ClO2S — CID 154972761

IUPAC(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid
SMILESC=C/C(=C\C=C(/C)Cl)S(=O)O
InChIInChI=1S/C7H9ClO2S/c1-3-7(11(9)10)5-4-6(2)8/h3-5H,1H2,2H3,(H,9,10)/b6-4+,7-5+
InChIKeyNGILBMIIRNNXLA-YDFGWWAZSA-N
MW192.67 g/mol
LogP2.42
Rot. Bonds3

About (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid

(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid (PubChem CID 154972761) has the molecular formula C7H9ClO2S and a molecular weight of 192.67 g/mol. Its IUPAC name is (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid.

Molecular Properties

Compound Name(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid
PubChem CID154972761
Molecular FormulaC7H9ClO2S
Molecular Weight192.67 g/mol
Exact Mass192.00
IUPAC Name(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid
SMILESC=C/C(=C\C=C(/C)Cl)S(=O)O
InChIInChI=1S/C7H9ClO2S/c1-3-7(11(9)10)5-4-6(2)8/h3-5H,1H2,2H3,(H,9,10)/b6-4+,7-5+
InChIKeyNGILBMIIRNNXLA-YDFGWWAZSA-N
XLogP2.42
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.67
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid?
The IUPAC name of (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid (CID 154972761) is (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid.
What is the SMILES notation for (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid?
The canonical SMILES for (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid is C=C/C(=C\C=C(/C)Cl)S(=O)O.
What is the InChIKey of (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid?
The InChIKey is NGILBMIIRNNXLA-YDFGWWAZSA-N. The full InChI is InChI=1S/C7H9ClO2S/c1-3-7(11(9)10)5-4-6(2)8/h3-5H,1H2,2H3,(H,9,10)/b6-4+,7-5+.
What are the key properties of (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid?
(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid has a molecular weight of 192.67 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid is sourced from PubChem (CID 154972761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).