C7H9ClO2S — CID 154972761
(3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid (PubChem CID 154972761) has the molecular formula C7H9ClO2S and a molecular weight of 192.67 g/mol. Its IUPAC name is (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid.
| Compound Name | (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid |
|---|---|
| PubChem CID | 154972761 |
| Molecular Formula | C7H9ClO2S |
| Molecular Weight | 192.67 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | (3E,5E)-6-chlorohepta-1,3,5-triene-3-sulfinic acid |
| SMILES | C=C/C(=C\C=C(/C)Cl)S(=O)O |
| InChI | InChI=1S/C7H9ClO2S/c1-3-7(11(9)10)5-4-6(2)8/h3-5H,1H2,2H3,(H,9,10)/b6-4+,7-5+ |
| InChIKey | NGILBMIIRNNXLA-YDFGWWAZSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|