C8H11ClO — CID 123359720
6-chloro-3-methylhepta-3,5-dien-2-one (PubChem CID 123359720) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is 6-chloro-3-methylhepta-3,5-dien-2-one.
| Compound Name | 6-chloro-3-methylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 123359720 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 6-chloro-3-methylhepta-3,5-dien-2-one |
| SMILES | CC(=O)C(C)=CC=C(C)Cl |
| InChI | InChI=1S/C8H11ClO/c1-6(8(3)10)4-5-7(2)9/h4-5H,1-3H3 |
| InChIKey | NGVFFVQDZRVFMB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|