C23H28O9 — CID 158800502
(2Z,4Z)-2,5-dimethyl-6-oxohepta-2,4-dienoic acid;(2Z,4Z)-6-oxohepta-2,4-dienoic acid;(2E,4E)-6-oxohepta-2,4-dienoic acid (PubChem CID 158800502) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is (2Z,4Z)-2,5-dimethyl-6-oxohepta-2,4-dienoic acid;(2Z,4Z)-6-oxohepta-2,4-dienoic acid;(2E,4E)-6-oxohepta-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-2,5-dimethyl-6-oxohepta-2,4-dienoic acid;(2Z,4Z)-6-oxohepta-2,4-dienoic acid;(2E,4E)-6-oxohepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 158800502 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2Z,4Z)-2,5-dimethyl-6-oxohepta-2,4-dienoic acid;(2Z,4Z)-6-oxohepta-2,4-dienoic acid;(2E,4E)-6-oxohepta-2,4-dienoic acid |
| SMILES | CC(=O)/C(C)=C\C=C(\C)C(=O)O.CC(=O)/C=C/C=C/C(=O)O.CC(=O)/C=C\C=C/C(=O)O |
| InChI | InChI=1S/C9H12O3.2C7H8O3/c1-6(8(3)10)4-5-7(2)9(11)12;2*1-6(8)4-2-3-5-7(9)10/h4-5H,1-3H3,(H,11,12);2*2-5H,1H3,(H,9,10)/b6-4-,7-5-;4-2+,5-3+;4-2-,5-3- |
| InChIKey | ITKQGFLKTHNOAP-CMUUDUQFSA-N |
| XLogP | 3.10 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|