About (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol
(3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol (PubChem CID 130437655) has the molecular formula C8H14ClNS
and a molecular weight of 191.73 g/mol. Its IUPAC name is (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol.
Molecular Properties
| Compound Name | (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol |
| PubChem CID | 130437655 |
| Molecular Formula | C8H14ClNS |
| Molecular Weight | 191.73 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol |
| SMILES | CC(C)=C/C(Cl)=C(\S)C(C)N |
| InChI | InChI=1S/C8H14ClNS/c1-5(2)4-7(9)8(11)6(3)10/h4,6,11H,10H2,1-3H3/b8-7+ |
| InChIKey | JEPYBFAQQLYRQN-BQYQJAHWSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol?
The IUPAC name of (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol (CID 130437655) is (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol.
What is the SMILES notation for (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol?
The canonical SMILES for (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol is CC(C)=C/C(Cl)=C(\S)C(C)N.
What is the InChIKey of (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol?
The InChIKey is JEPYBFAQQLYRQN-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H14ClNS/c1-5(2)4-7(9)8(11)6(3)10/h4,6,11H,10H2,1-3H3/b8-7+.
What are the key properties of (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol?
(3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol has a molecular weight of 191.73 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol is sourced from PubChem (CID 130437655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).