C8H14ClNS — CID 130437655
(3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol (PubChem CID 130437655) has the molecular formula C8H14ClNS and a molecular weight of 191.73 g/mol. Its IUPAC name is (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol.
| Compound Name | (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol |
|---|---|
| PubChem CID | 130437655 |
| Molecular Formula | C8H14ClNS |
| Molecular Weight | 191.73 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (3E)-2-amino-4-chloro-6-methylhepta-3,5-diene-3-thiol |
| SMILES | CC(C)=C/C(Cl)=C(\S)C(C)N |
| InChI | InChI=1S/C8H14ClNS/c1-5(2)4-7(9)8(11)6(3)10/h4,6,11H,10H2,1-3H3/b8-7+ |
| InChIKey | JEPYBFAQQLYRQN-BQYQJAHWSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|