About (2R)-2-aminopropanethioic S-acid;oxalic acid
(2R)-2-aminopropanethioic S-acid;oxalic acid (PubChem CID 162046267) has the molecular formula C5H9NO5S
and a molecular weight of 195.20 g/mol. Its IUPAC name is (2R)-2-aminopropanethioic S-acid;oxalic acid.
Molecular Properties
| Compound Name | (2R)-2-aminopropanethioic S-acid;oxalic acid |
| PubChem CID | 162046267 |
| Molecular Formula | C5H9NO5S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (2R)-2-aminopropanethioic S-acid;oxalic acid |
| SMILES | C[C@@H](N)C(=O)S.O=C(O)C(=O)O |
| InChI | InChI=1S/C3H7NOS.C2H2O4/c1-2(4)3(5)6;3-1(4)2(5)6/h2H,4H2,1H3,(H,5,6);(H,3,4)(H,5,6)/t2-;/m1./s1 |
| InChIKey | HPINVGYODIACTG-HSHFZTNMSA-N |
| XLogP | -1.05 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-aminopropanethioic S-acid;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminopropanethioic S-acid;oxalic acid?
The IUPAC name of (2R)-2-aminopropanethioic S-acid;oxalic acid (CID 162046267) is (2R)-2-aminopropanethioic S-acid;oxalic acid.
What is the SMILES notation for (2R)-2-aminopropanethioic S-acid;oxalic acid?
The canonical SMILES for (2R)-2-aminopropanethioic S-acid;oxalic acid is C[C@@H](N)C(=O)S.O=C(O)C(=O)O.
What is the InChIKey of (2R)-2-aminopropanethioic S-acid;oxalic acid?
The InChIKey is HPINVGYODIACTG-HSHFZTNMSA-N. The full InChI is InChI=1S/C3H7NOS.C2H2O4/c1-2(4)3(5)6;3-1(4)2(5)6/h2H,4H2,1H3,(H,5,6);(H,3,4)(H,5,6)/t2-;/m1./s1.
What are the key properties of (2R)-2-aminopropanethioic S-acid;oxalic acid?
(2R)-2-aminopropanethioic S-acid;oxalic acid has a molecular weight of 195.20 g/mol, XLogP of -1.05, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminopropanethioic S-acid;oxalic acid is sourced from PubChem (CID 162046267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).