About alumane;ethane-1,1-diamine
alumane;ethane-1,1-diamine (PubChem CID 174593574) has the molecular formula C2H11AlN2
and a molecular weight of 90.11 g/mol. Its IUPAC name is alumane;ethane-1,1-diamine.
Molecular Properties
| Compound Name | alumane;ethane-1,1-diamine |
| PubChem CID | 174593574 |
| Molecular Formula | C2H11AlN2 |
| Molecular Weight | 90.11 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | alumane;ethane-1,1-diamine |
| SMILES | CC(N)N.[AlH3] |
| InChI | InChI=1S/C2H8N2.Al.3H/c1-2(3)4;;;;/h2H,3-4H2,1H3;;;; |
| InChIKey | TYFBAHHJFHHPSN-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.11 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze alumane;ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;ethane-1,1-diamine?
The IUPAC name of alumane;ethane-1,1-diamine (CID 174593574) is alumane;ethane-1,1-diamine.
What is the SMILES notation for alumane;ethane-1,1-diamine?
The canonical SMILES for alumane;ethane-1,1-diamine is CC(N)N.[AlH3].
What is the InChIKey of alumane;ethane-1,1-diamine?
The InChIKey is TYFBAHHJFHHPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2.Al.3H/c1-2(3)4;;;;/h2H,3-4H2,1H3;;;;.
What are the key properties of alumane;ethane-1,1-diamine?
alumane;ethane-1,1-diamine has a molecular weight of 90.11 g/mol, XLogP of -1.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;ethane-1,1-diamine is sourced from PubChem (CID 174593574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).