About potassium;boranuide;propan-2-amine
potassium;boranuide;propan-2-amine (PubChem CID 174884130) has the molecular formula C3H13BKN
and a molecular weight of 113.05 g/mol. Its IUPAC name is potassium;boranuide;propan-2-amine.
Molecular Properties
| Compound Name | potassium;boranuide;propan-2-amine |
| PubChem CID | 174884130 |
| Molecular Formula | C3H13BKN |
| Molecular Weight | 113.05 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | potassium;boranuide;propan-2-amine |
| SMILES | CC(C)N.[BH4-].[K+] |
| InChI | InChI=1S/C3H9N.BH4.K/c1-3(2)4;;/h3H,4H2,1-2H3;1H4;/q;-1;+1 |
| InChIKey | JAGHHEQGYQXVPX-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.05 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;boranuide;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;boranuide;propan-2-amine?
The IUPAC name of potassium;boranuide;propan-2-amine (CID 174884130) is potassium;boranuide;propan-2-amine.
What is the SMILES notation for potassium;boranuide;propan-2-amine?
The canonical SMILES for potassium;boranuide;propan-2-amine is CC(C)N.[BH4-].[K+].
What is the InChIKey of potassium;boranuide;propan-2-amine?
The InChIKey is JAGHHEQGYQXVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.BH4.K/c1-3(2)4;;/h3H,4H2,1-2H3;1H4;/q;-1;+1.
What are the key properties of potassium;boranuide;propan-2-amine?
potassium;boranuide;propan-2-amine has a molecular weight of 113.05 g/mol, XLogP of -4.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;boranuide;propan-2-amine is sourced from PubChem (CID 174884130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).