About propan-2-amine;hydrate;hydrochloride
propan-2-amine;hydrate;hydrochloride (PubChem CID 162153809) has the molecular formula C3H12ClNO
and a molecular weight of 113.59 g/mol. Its IUPAC name is propan-2-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-amine;hydrate;hydrochloride |
| PubChem CID | 162153809 |
| Molecular Formula | C3H12ClNO |
| Molecular Weight | 113.59 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | propan-2-amine;hydrate;hydrochloride |
| SMILES | CC(C)N.Cl.O |
| InChI | InChI=1S/C3H9N.ClH.H2O/c1-3(2)4;;/h3H,4H2,1-2H3;1H;1H2 |
| InChIKey | ZLODAHKGGXALOP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.59 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;hydrate;hydrochloride?
The IUPAC name of propan-2-amine;hydrate;hydrochloride (CID 162153809) is propan-2-amine;hydrate;hydrochloride.
What is the SMILES notation for propan-2-amine;hydrate;hydrochloride?
The canonical SMILES for propan-2-amine;hydrate;hydrochloride is CC(C)N.Cl.O.
What is the InChIKey of propan-2-amine;hydrate;hydrochloride?
The InChIKey is ZLODAHKGGXALOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.ClH.H2O/c1-3(2)4;;/h3H,4H2,1-2H3;1H;1H2.
What are the key properties of propan-2-amine;hydrate;hydrochloride?
propan-2-amine;hydrate;hydrochloride has a molecular weight of 113.59 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;hydrate;hydrochloride is sourced from PubChem (CID 162153809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).