About oxosilver;propan-2-amine
oxosilver;propan-2-amine (PubChem CID 158348273) has the molecular formula C3H9AgNO
and a molecular weight of 182.98 g/mol. Its IUPAC name is oxosilver;propan-2-amine.
Molecular Properties
| Compound Name | oxosilver;propan-2-amine |
| PubChem CID | 158348273 |
| Molecular Formula | C3H9AgNO |
| Molecular Weight | 182.98 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | oxosilver;propan-2-amine |
| SMILES | CC(C)N.O=[Ag] |
| InChI | InChI=1S/C3H9N.Ag.O/c1-3(2)4;;/h3H,4H2,1-2H3;; |
| InChIKey | GRZQZLLTSNBBHE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.98 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxosilver;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxosilver;propan-2-amine?
The IUPAC name of oxosilver;propan-2-amine (CID 158348273) is oxosilver;propan-2-amine.
What is the SMILES notation for oxosilver;propan-2-amine?
The canonical SMILES for oxosilver;propan-2-amine is CC(C)N.O=[Ag].
What is the InChIKey of oxosilver;propan-2-amine?
The InChIKey is GRZQZLLTSNBBHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.Ag.O/c1-3(2)4;;/h3H,4H2,1-2H3;;.
What are the key properties of oxosilver;propan-2-amine?
oxosilver;propan-2-amine has a molecular weight of 182.98 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxosilver;propan-2-amine is sourced from PubChem (CID 158348273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).