C15H32 — CID 143986443
2,5-dimethyl-3-propan-2-ylhexa-2,4-diene;ethane (PubChem CID 143986443) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 2,5-dimethyl-3-propan-2-ylhexa-2,4-diene;ethane.
| Compound Name | 2,5-dimethyl-3-propan-2-ylhexa-2,4-diene;ethane |
|---|---|
| PubChem CID | 143986443 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2,5-dimethyl-3-propan-2-ylhexa-2,4-diene;ethane |
| SMILES | CC.CC.CC(C)=CC(=C(C)C)C(C)C |
| InChI | InChI=1S/C11H20.2C2H6/c1-8(2)7-11(9(3)4)10(5)6;2*1-2/h7,9H,1-6H3;2*1-2H3 |
| InChIKey | CGVJEXYCUOYUJD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|