C19H33N — CID 170099965
(2E,4Z,6E)-N-ethyl-N,2,6,9-tetramethyl-8-propan-2-yldeca-2,4,6,8-tetraen-1-amine (PubChem CID 170099965) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (2E,4Z,6E)-N-ethyl-N,2,6,9-tetramethyl-8-propan-2-yldeca-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4Z,6E)-N-ethyl-N,2,6,9-tetramethyl-8-propan-2-yldeca-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 170099965 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (2E,4Z,6E)-N-ethyl-N,2,6,9-tetramethyl-8-propan-2-yldeca-2,4,6,8-tetraen-1-amine |
| SMILES | CCN(C)C/C(C)=C/C=C\C(C)=C\C(=C(C)C)C(C)C |
| InChI | InChI=1S/C19H33N/c1-9-20(8)14-18(7)12-10-11-17(6)13-19(15(2)3)16(4)5/h10-13,15H,9,14H2,1-8H3/b11-10-,17-13+,18-12+ |
| InChIKey | HELFQWDUMJGHJC-UJCYOUSSSA-N |
| XLogP | 5.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|