C11H20O — CID 143347257
(2E,4E)-5-methyl-3-propan-2-ylhepta-2,4-dien-2-ol (PubChem CID 143347257) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2E,4E)-5-methyl-3-propan-2-ylhepta-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-methyl-3-propan-2-ylhepta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 143347257 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2E,4E)-5-methyl-3-propan-2-ylhepta-2,4-dien-2-ol |
| SMILES | CC/C(C)=C/C(=C(\C)O)C(C)C |
| InChI | InChI=1S/C11H20O/c1-6-9(4)7-11(8(2)3)10(5)12/h7-8,12H,6H2,1-5H3/b9-7+,11-10- |
| InChIKey | DQUNAQHUDIROHE-GLYMIEGHSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|