C11H20O — CID 5363138
(3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol (PubChem CID 5363138) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol.
| Compound Name | (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 5363138 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol |
| SMILES | CC(C)=C(/C=C/C(C)O)C(C)C |
| InChI | InChI=1S/C11H20O/c1-8(2)11(9(3)4)7-6-10(5)12/h6-8,10,12H,1-5H3/b7-6+ |
| InChIKey | YMAQXOPPAMCPRY-VOTSOKGWSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|