About (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol
(3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol (PubChem CID 5363138) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol |
| PubChem CID | 5363138 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol |
| SMILES | CC(C)=C(/C=C/C(C)O)C(C)C |
| InChI | InChI=1S/C11H20O/c1-8(2)11(9(3)4)7-6-10(5)12/h6-8,10,12H,1-5H3/b7-6+ |
| InChIKey | YMAQXOPPAMCPRY-VOTSOKGWSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol?
The IUPAC name of (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol (CID 5363138) is (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol.
What is the SMILES notation for (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol?
The canonical SMILES for (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol is CC(C)=C(/C=C/C(C)O)C(C)C.
What is the InChIKey of (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol?
The InChIKey is YMAQXOPPAMCPRY-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H20O/c1-8(2)11(9(3)4)7-6-10(5)12/h6-8,10,12H,1-5H3/b7-6+.
What are the key properties of (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol?
(3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol has a molecular weight of 168.28 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-methyl-5-propan-2-ylhepta-3,5-dien-2-ol is sourced from PubChem (CID 5363138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).