C13H24 — CID 143550597
(3Z)-2,6-dimethyl-5-propan-2-ylhepta-1,3,5-triene;methane (PubChem CID 143550597) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3Z)-2,6-dimethyl-5-propan-2-ylhepta-1,3,5-triene;methane.
| Compound Name | (3Z)-2,6-dimethyl-5-propan-2-ylhepta-1,3,5-triene;methane |
|---|---|
| PubChem CID | 143550597 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3Z)-2,6-dimethyl-5-propan-2-ylhepta-1,3,5-triene;methane |
| SMILES | C.C=C(C)/C=C\C(=C(C)C)C(C)C |
| InChI | InChI=1S/C12H20.CH4/c1-9(2)7-8-12(10(3)4)11(5)6;/h7-8,10H,1H2,2-6H3;1H4/b8-7-; |
| InChIKey | OOKIOQYZGSQCCQ-CFYXSCKTSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|