C10H15Cl2N — CID 123746419
N-(1,3-dichloro-4-methylhexa-1,3-dienyl)propan-2-imine (PubChem CID 123746419) has the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. Its IUPAC name is N-(1,3-dichloro-4-methylhexa-1,3-dienyl)propan-2-imine.
| Compound Name | N-(1,3-dichloro-4-methylhexa-1,3-dienyl)propan-2-imine |
|---|---|
| PubChem CID | 123746419 |
| Molecular Formula | C10H15Cl2N |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-(1,3-dichloro-4-methylhexa-1,3-dienyl)propan-2-imine |
| SMILES | CCC(C)=C(Cl)C=C(Cl)N=C(C)C |
| InChI | InChI=1S/C10H15Cl2N/c1-5-8(4)9(11)6-10(12)13-7(2)3/h6H,5H2,1-4H3 |
| InChIKey | WUUCGOHSZPSYSV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|