C8H14ClN — CID 145473645
(2E,4E)-3-chloro-5-methylhepta-2,4-dien-4-amine (PubChem CID 145473645) has the molecular formula C8H14ClN and a molecular weight of 159.66 g/mol. Its IUPAC name is (2E,4E)-3-chloro-5-methylhepta-2,4-dien-4-amine.
| Compound Name | (2E,4E)-3-chloro-5-methylhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 145473645 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (2E,4E)-3-chloro-5-methylhepta-2,4-dien-4-amine |
| SMILES | C/C=C(Cl)\C(N)=C(\C)CC |
| InChI | InChI=1S/C8H14ClN/c1-4-6(3)8(10)7(9)5-2/h5H,4,10H2,1-3H3/b7-5+,8-6+ |
| InChIKey | HPDGJEFLZHRAOR-KQQUZDAGSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|