C10H18ClN — CID 171794714
(3E,5E)-5-chloro-N,3-dimethylocta-3,5-dien-4-amine (PubChem CID 171794714) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is (3E,5E)-5-chloro-N,3-dimethylocta-3,5-dien-4-amine.
| Compound Name | (3E,5E)-5-chloro-N,3-dimethylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 171794714 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (3E,5E)-5-chloro-N,3-dimethylocta-3,5-dien-4-amine |
| SMILES | CC/C=C(Cl)\C(NC)=C(\C)CC |
| InChI | InChI=1S/C10H18ClN/c1-5-7-9(11)10(12-4)8(3)6-2/h7,12H,5-6H2,1-4H3/b9-7+,10-8+ |
| InChIKey | OWQACDXUQXBVDL-FIFLTTCUSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|