C9H17N3O — CID 143941192
(E)-2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylpent-2-enamide (PubChem CID 143941192) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylpent-2-enamide.
| Compound Name | (E)-2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 143941192 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (E)-2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylpent-2-enamide |
| SMILES | C/C=N\N/C(C(=O)NC)=C(\C)CC |
| InChI | InChI=1S/C9H17N3O/c1-5-7(3)8(9(13)10-4)12-11-6-2/h6,12H,5H2,1-4H3,(H,10,13)/b8-7+,11-6- |
| InChIKey | MUQRHENIGJWLDG-UTGOSBLHSA-N |
| XLogP | 1.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|